C25H36N2O5 — CID 138469527
tert-butyl 3-amino-4-[2,2-diethoxyethyl(naphthalen-2-ylmethyl)amino]-4-oxobutanoate (PubChem CID 138469527) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is tert-butyl 3-amino-4-[2,2-diethoxyethyl(naphthalen-2-ylmethyl)amino]-4-oxobutanoate.
| Compound Name | tert-butyl 3-amino-4-[2,2-diethoxyethyl(naphthalen-2-ylmethyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 138469527 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | tert-butyl 3-amino-4-[2,2-diethoxyethyl(naphthalen-2-ylmethyl)amino]-4-oxobutanoate |
| SMILES | CCOC(CN(Cc1ccc2ccccc2c1)C(=O)C(N)CC(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C25H36N2O5/c1-6-30-23(31-7-2)17-27(24(29)21(26)15-22(28)32-25(3,4)5)16-18-12-13-19-10-8-9-11-20(19)14-18/h8-14,21,23H,6-7,15-17,26H2,1-5H3 |
| InChIKey | PGPGTDSLTZZLRG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|