C27H37ClN2O5 — CID 139757414
tert-butyl N-[(2S)-1-[benzyl(2,2-diethoxyethyl)amino]-3-(4-chlorophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 139757414) has the molecular formula C27H37ClN2O5 and a molecular weight of 505.06 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[benzyl(2,2-diethoxyethyl)amino]-3-(4-chlorophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[benzyl(2,2-diethoxyethyl)amino]-3-(4-chlorophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 139757414 |
| Molecular Formula | C27H37ClN2O5 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-[benzyl(2,2-diethoxyethyl)amino]-3-(4-chlorophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCOC(CN(Cc1ccccc1)C(=O)[C@H](Cc1ccc(Cl)cc1)NC(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C27H37ClN2O5/c1-6-33-24(34-7-2)19-30(18-21-11-9-8-10-12-21)25(31)23(29-26(32)35-27(3,4)5)17-20-13-15-22(28)16-14-20/h8-16,23-24H,6-7,17-19H2,1-5H3,(H,29,32)/t23-/m0/s1 |
| InChIKey | FBRDKVPOWQBXCQ-QHCPKHFHSA-N |
| XLogP | 5.20 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|