C22H30N2O3 — CID 11624892
tert-butyl N-[(2R)-1-(diethylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate (PubChem CID 11624892) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(diethylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(diethylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11624892 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | tert-butyl N-[(2R)-1-(diethylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate |
| SMILES | CCN(CC)C(=O)[C@@H](Cc1ccc2ccccc2c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N2O3/c1-6-24(7-2)20(25)19(23-21(26)27-22(3,4)5)15-16-12-13-17-10-8-9-11-18(17)14-16/h8-14,19H,6-7,15H2,1-5H3,(H,23,26)/t19-/m1/s1 |
| InChIKey | XNHOTZAXTBGIOD-LJQANCHMSA-N |
| XLogP | 4.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |