C18H20ClNO3S — CID 91267967
(2S)-3-(6-chloronaphthalen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioic S-acid (PubChem CID 91267967) has the molecular formula C18H20ClNO3S and a molecular weight of 365.88 g/mol. Its IUPAC name is (2S)-3-(6-chloronaphthalen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioic S-acid.
| Compound Name | (2S)-3-(6-chloronaphthalen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioic S-acid |
|---|---|
| PubChem CID | 91267967 |
| Molecular Formula | C18H20ClNO3S |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (2S)-3-(6-chloronaphthalen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioic S-acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc2cc(Cl)ccc2c1)C(=O)S |
| InChI | InChI=1S/C18H20ClNO3S/c1-18(2,3)23-17(22)20-15(16(21)24)9-11-4-5-13-10-14(19)7-6-12(13)8-11/h4-8,10,15H,9H2,1-3H3,(H,20,22)(H,21,24)/t15-/m0/s1 |
| InChIKey | SHXJQQLDWIZKJL-HNNXBMFYSA-N |
| XLogP | 4.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|