C21H29N3O3 — CID 163240345
(2S)-2-amino-N-(2,2-diethoxyethyl)-3-phenyl-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 163240345) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,2-diethoxyethyl)-3-phenyl-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-3-phenyl-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 163240345 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-3-phenyl-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | CCOC(CN(Cc1ccncc1)C(=O)[C@@H](N)Cc1ccccc1)OCC |
| InChI | InChI=1S/C21H29N3O3/c1-3-26-20(27-4-2)16-24(15-18-10-12-23-13-11-18)21(25)19(22)14-17-8-6-5-7-9-17/h5-13,19-20H,3-4,14-16,22H2,1-2H3/t19-/m0/s1 |
| InChIKey | AZSVFTKHOLLGHB-IBGZPJMESA-N |
| XLogP | 2.38 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|