C30H38N2O3 — CID 138469613
(2S)-2-amino-N-(2,2-diethoxyethyl)-N-(3,3-diphenylpropyl)-3-phenylpropanamide (PubChem CID 138469613) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(3,3-diphenylpropyl)-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(3,3-diphenylpropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 138469613 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(3,3-diphenylpropyl)-3-phenylpropanamide |
| SMILES | CCOC(CN(CCC(c1ccccc1)c1ccccc1)C(=O)[C@@H](N)Cc1ccccc1)OCC |
| InChI | InChI=1S/C30H38N2O3/c1-3-34-29(35-4-2)23-32(30(33)28(31)22-24-14-8-5-9-15-24)21-20-27(25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,27-29H,3-4,20-23,31H2,1-2H3/t28-/m0/s1 |
| InChIKey | GHQUNBVZTORYSW-NDEPHWFRSA-N |
| XLogP | 5.01 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|