C44H46N2O5 — CID 138469469
9H-fluoren-9-ylmethyl N-[2-[2,2-diethoxyethyl(3,3-diphenylpropyl)amino]-2-oxo-1-phenylethyl]carbamate (PubChem CID 138469469) has the molecular formula C44H46N2O5 and a molecular weight of 682.86 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[2,2-diethoxyethyl(3,3-diphenylpropyl)amino]-2-oxo-1-phenylethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[2,2-diethoxyethyl(3,3-diphenylpropyl)amino]-2-oxo-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 138469469 |
| Molecular Formula | C44H46N2O5 |
| Molecular Weight | 682.86 g/mol |
| Exact Mass | 682.34 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[2,2-diethoxyethyl(3,3-diphenylpropyl)amino]-2-oxo-1-phenylethyl]carbamate |
| SMILES | CCOC(CN(CCC(c1ccccc1)c1ccccc1)C(=O)C(NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccccc1)OCC |
| InChI | InChI=1S/C44H46N2O5/c1-3-49-41(50-4-2)30-46(29-28-35(32-18-8-5-9-19-32)33-20-10-6-11-21-33)43(47)42(34-22-12-7-13-23-34)45-44(48)51-31-40-38-26-16-14-24-36(38)37-25-15-17-27-39(37)40/h5-27,35,40-42H,3-4,28-31H2,1-2H3,(H,45,48) |
| InChIKey | USQCOJKWGRWQPO-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.86 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|