C34H42N2O5 — CID 138469585
9H-fluoren-9-ylmethyl N-[2-[2,2-diethoxyethyl(3-methylbutyl)amino]-2-oxo-1-phenylethyl]carbamate (PubChem CID 138469585) has the molecular formula C34H42N2O5 and a molecular weight of 558.72 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[2,2-diethoxyethyl(3-methylbutyl)amino]-2-oxo-1-phenylethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[2,2-diethoxyethyl(3-methylbutyl)amino]-2-oxo-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 138469585 |
| Molecular Formula | C34H42N2O5 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[2,2-diethoxyethyl(3-methylbutyl)amino]-2-oxo-1-phenylethyl]carbamate |
| SMILES | CCOC(CN(CCC(C)C)C(=O)C(NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccccc1)OCC |
| InChI | InChI=1S/C34H42N2O5/c1-5-39-31(40-6-2)22-36(21-20-24(3)4)33(37)32(25-14-8-7-9-15-25)35-34(38)41-23-30-28-18-12-10-16-26(28)27-17-11-13-19-29(27)30/h7-19,24,30-32H,5-6,20-23H2,1-4H3,(H,35,38) |
| InChIKey | BHCFVFKTMQCSCA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|