C20H23NO2 — CID 142703958
9H-fluoren-9-ylmethyl N-[(2R)-pentan-2-yl]carbamate (PubChem CID 142703958) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2R)-pentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2R)-pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 142703958 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2R)-pentan-2-yl]carbamate |
| SMILES | CCC[C@@H](C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H23NO2/c1-3-8-14(2)21-20(22)23-13-19-17-11-6-4-9-15(17)16-10-5-7-12-18(16)19/h4-7,9-12,14,19H,3,8,13H2,1-2H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | RUUFLOFYPMEIGJ-CQSZACIVSA-N |
| XLogP | 4.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |