C18H19NO2S — CID 20732098
9H-fluoren-9-ylmethyl N-(1-sulfanylpropan-2-yl)carbamate (PubChem CID 20732098) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(1-sulfanylpropan-2-yl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(1-sulfanylpropan-2-yl)carbamate |
|---|---|
| PubChem CID | 20732098 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(1-sulfanylpropan-2-yl)carbamate |
| SMILES | CC(CS)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H19NO2S/c1-12(11-22)19-18(20)21-10-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,12,17,22H,10-11H2,1H3,(H,19,20) |
| InChIKey | VHHOQQMSKOYFQF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|