C18H18INO2 — CID 101460179
9H-fluoren-9-ylmethyl N-[(2R)-1-iodopropan-2-yl]carbamate (PubChem CID 101460179) has the molecular formula C18H18INO2 and a molecular weight of 407.25 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2R)-1-iodopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2R)-1-iodopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 101460179 |
| Molecular Formula | C18H18INO2 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2R)-1-iodopropan-2-yl]carbamate |
| SMILES | C[C@H](CI)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H18INO2/c1-12(10-19)20-18(21)22-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,12,17H,10-11H2,1H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | JGQSGVAHYBUYKG-GFCCVEGCSA-N |
| XLogP | 4.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|