C20H20INO4 — CID 91667085
methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-iodobutanoate (PubChem CID 91667085) has the molecular formula C20H20INO4 and a molecular weight of 465.29 g/mol. Its IUPAC name is methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-iodobutanoate.
| Compound Name | methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-iodobutanoate |
|---|---|
| PubChem CID | 91667085 |
| Molecular Formula | C20H20INO4 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | methyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-iodobutanoate |
| SMILES | COC(=O)[C@@H](CCI)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H20INO4/c1-25-19(23)18(10-11-21)22-20(24)26-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17-18H,10-12H2,1H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | RAPINIFWJKOFMR-GOSISDBHSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|