C19H18NO4 — CID 101120722
CID 101120722 (PubChem CID 101120722) has the molecular formula C19H18NO4 and a molecular weight of 324.36 g/mol.
| Compound Name | CID 101120722 |
|---|---|
| PubChem CID | 101120722 |
| Molecular Formula | C19H18NO4 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | — |
| SMILES | [CH2][C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC |
| InChI | InChI=1S/C19H18NO4/c1-12(18(21)23-2)20-19(22)24-11-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,12,17H,1,11H2,2H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | XDMBJTDRLOFOKO-LBPRGKRZSA-N |
| XLogP | 2.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |