C20H20INO2 — CID 123810740
9H-fluoren-9-ylmethyl N-[(3S)-1-iodopent-1-en-3-yl]carbamate (PubChem CID 123810740) has the molecular formula C20H20INO2 and a molecular weight of 433.29 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(3S)-1-iodopent-1-en-3-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(3S)-1-iodopent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 123810740 |
| Molecular Formula | C20H20INO2 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(3S)-1-iodopent-1-en-3-yl]carbamate |
| SMILES | CC[C@@H](C=CI)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H20INO2/c1-2-14(11-12-21)22-20(23)24-13-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-12,14,19H,2,13H2,1H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | HUQRJEWCPYAJSH-AWEZNQCLSA-N |
| XLogP | 5.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|