C18H19NO3 — CID 6924106
9H-fluoren-9-ylmethyl N-[(2S)-1-hydroxypropan-2-yl]carbamate (PubChem CID 6924106) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-hydroxypropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 6924106 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-hydroxypropan-2-yl]carbamate |
| SMILES | C[C@@H](CO)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H19NO3/c1-12(10-20)19-18(21)22-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,12,17,20H,10-11H2,1H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | GIZCEJUGNDJXMH-LBPRGKRZSA-N |
| XLogP | 2.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |