C20H23NO3S — CID 106156061
9H-fluoren-9-ylmethyl N-(4-hydroxy-3-methylsulfanylbutan-2-yl)carbamate (PubChem CID 106156061) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(4-hydroxy-3-methylsulfanylbutan-2-yl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(4-hydroxy-3-methylsulfanylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 106156061 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(4-hydroxy-3-methylsulfanylbutan-2-yl)carbamate |
| SMILES | CSC(CO)C(C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H23NO3S/c1-13(19(11-22)25-2)21-20(23)24-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19,22H,11-12H2,1-2H3,(H,21,23) |
| InChIKey | UNAFYPRKHMULBS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |