C31H26N2O5 — CID 170836423
2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetyl]amino]-2-phenylacetic acid (PubChem CID 170836423) has the molecular formula C31H26N2O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 170836423 |
| Molecular Formula | C31H26N2O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetyl]amino]-2-phenylacetic acid |
| SMILES | O=C(NC(C(=O)NC(C(=O)O)c1ccccc1)c1ccccc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H26N2O5/c34-29(32-28(30(35)36)21-13-5-2-6-14-21)27(20-11-3-1-4-12-20)33-31(37)38-19-26-24-17-9-7-15-22(24)23-16-8-10-18-25(23)26/h1-18,26-28H,19H2,(H,32,34)(H,33,37)(H,35,36) |
| InChIKey | UOXVCOXJLXWIKT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |