C27H26N2O3 — CID 156678521
9H-fluoren-9-ylmethyl N-[(1R)-2-[methyl(prop-2-enyl)amino]-2-oxo-1-phenylethyl]carbamate (PubChem CID 156678521) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(1R)-2-[methyl(prop-2-enyl)amino]-2-oxo-1-phenylethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(1R)-2-[methyl(prop-2-enyl)amino]-2-oxo-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 156678521 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(1R)-2-[methyl(prop-2-enyl)amino]-2-oxo-1-phenylethyl]carbamate |
| SMILES | C=CCN(C)C(=O)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O3/c1-3-17-29(2)26(30)25(19-11-5-4-6-12-19)28-27(31)32-18-24-22-15-9-7-13-20(22)21-14-8-10-16-23(21)24/h3-16,24-25H,1,17-18H2,2H3,(H,28,31)/t25-/m1/s1 |
| InChIKey | MSDMAJLMRGCBHE-RUZDIDTESA-N |
| XLogP | 4.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|