C21H36N2O3 — CID 169240661
(2R)-2-(aminomethyl)-N-(2,2-diethoxyethyl)-N-(3-methylbutyl)-3-phenylpropanamide (PubChem CID 169240661) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is (2R)-2-(aminomethyl)-N-(2,2-diethoxyethyl)-N-(3-methylbutyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-(aminomethyl)-N-(2,2-diethoxyethyl)-N-(3-methylbutyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 169240661 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | (2R)-2-(aminomethyl)-N-(2,2-diethoxyethyl)-N-(3-methylbutyl)-3-phenylpropanamide |
| SMILES | CCOC(CN(CCC(C)C)C(=O)[C@@H](CN)Cc1ccccc1)OCC |
| InChI | InChI=1S/C21H36N2O3/c1-5-25-20(26-6-2)16-23(13-12-17(3)4)21(24)19(15-22)14-18-10-8-7-9-11-18/h7-11,17,19-20H,5-6,12-16,22H2,1-4H3/t19-/m1/s1 |
| InChIKey | IKFLEMXUKNHBPF-LJQANCHMSA-N |
| XLogP | 3.08 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|