C16H34N2O3S — CID 142536844
(2S)-2-amino-N-(2,2-diethoxyethyl)-N-(3-methylbutyl)-4-methylsulfanylbutanamide (PubChem CID 142536844) has the molecular formula C16H34N2O3S and a molecular weight of 334.53 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(3-methylbutyl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(3-methylbutyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 142536844 |
| Molecular Formula | C16H34N2O3S |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(3-methylbutyl)-4-methylsulfanylbutanamide |
| SMILES | CCOC(CN(CCC(C)C)C(=O)[C@@H](N)CCSC)OCC |
| InChI | InChI=1S/C16H34N2O3S/c1-6-20-15(21-7-2)12-18(10-8-13(3)4)16(19)14(17)9-11-22-5/h13-15H,6-12,17H2,1-5H3/t14-/m0/s1 |
| InChIKey | FRQSDVZBOIQWKA-AWEZNQCLSA-N |
| XLogP | 2.34 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|