C17H36N2OS — CID 104907780
(2R)-2-amino-N,N-dihexyl-4-methylsulfanylbutanamide (PubChem CID 104907780) has the molecular formula C17H36N2OS and a molecular weight of 316.56 g/mol. Its IUPAC name is (2R)-2-amino-N,N-dihexyl-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N,N-dihexyl-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104907780 |
| Molecular Formula | C17H36N2OS |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | (2R)-2-amino-N,N-dihexyl-4-methylsulfanylbutanamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)[C@H](N)CCSC |
| InChI | InChI=1S/C17H36N2OS/c1-4-6-8-10-13-19(14-11-9-7-5-2)17(20)16(18)12-15-21-3/h16H,4-15,18H2,1-3H3/t16-/m1/s1 |
| InChIKey | RNGFKWWBMGFANF-MRXNPFEDSA-N |
| XLogP | 4.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|