C13H28N2O — CID 103793770
(2R)-2-amino-N,N-dibutylpentanamide (PubChem CID 103793770) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is (2R)-2-amino-N,N-dibutylpentanamide.
| Compound Name | (2R)-2-amino-N,N-dibutylpentanamide |
|---|---|
| PubChem CID | 103793770 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | (2R)-2-amino-N,N-dibutylpentanamide |
| SMILES | CCCCN(CCCC)C(=O)[C@H](N)CCC |
| InChI | InChI=1S/C13H28N2O/c1-4-7-10-15(11-8-5-2)13(16)12(14)9-6-3/h12H,4-11,14H2,1-3H3/t12-/m1/s1 |
| InChIKey | UFMDRXUDASJHAY-GFCCVEGCSA-N |
| XLogP | 2.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |