C16H34N2O — CID 61164908
(2S)-2-amino-4-methyl-N,N-dipentylpentanamide (PubChem CID 61164908) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N,N-dipentylpentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N,N-dipentylpentanamide |
|---|---|
| PubChem CID | 61164908 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | (2S)-2-amino-4-methyl-N,N-dipentylpentanamide |
| SMILES | CCCCCN(CCCCC)C(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C16H34N2O/c1-5-7-9-11-18(12-10-8-6-2)16(19)15(17)13-14(3)4/h14-15H,5-13,17H2,1-4H3/t15-/m0/s1 |
| InChIKey | KIVZDDXHBSGMIU-HNNXBMFYSA-N |
| XLogP | 3.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|