C14H29NO — CID 2904869
N,N-dibutyl-2-methylpentanamide (PubChem CID 2904869) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is N,N-dibutyl-2-methylpentanamide.
| Compound Name | N,N-dibutyl-2-methylpentanamide |
|---|---|
| PubChem CID | 2904869 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | N,N-dibutyl-2-methylpentanamide |
| SMILES | CCCCN(CCCC)C(=O)C(C)CCC |
| InChI | InChI=1S/C14H29NO/c1-5-8-11-15(12-9-6-2)14(16)13(4)10-7-3/h13H,5-12H2,1-4H3 |
| InChIKey | LOWFQTNMIBYSAF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |