C12H19N3O — CID 4628054
N,N-bis(2-cyanoethyl)-2-methylpentanamide (PubChem CID 4628054) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-methylpentanamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-methylpentanamide |
|---|---|
| PubChem CID | 4628054 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-methylpentanamide |
| SMILES | CCCC(C)C(=O)N(CCC#N)CCC#N |
| InChI | InChI=1S/C12H19N3O/c1-3-6-11(2)12(16)15(9-4-7-13)10-5-8-14/h11H,3-6,9-10H2,1-2H3 |
| InChIKey | KCGTUOVBUJNOES-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |