C11H17N3O — CID 4627836
N,N-bis(2-cyanoethyl)-2-methylbutanamide (PubChem CID 4627836) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-methylbutanamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 4627836 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-methylbutanamide |
| SMILES | CCC(C)C(=O)N(CCC#N)CCC#N |
| InChI | InChI=1S/C11H17N3O/c1-3-10(2)11(15)14(8-4-6-12)9-5-7-13/h10H,3-5,8-9H2,1-2H3 |
| InChIKey | QGGXGZMUIGAXIX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |