C15H32N2O — CID 80542996
4-amino-2-methyl-N,N-dipentylbutanamide (PubChem CID 80542996) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is 4-amino-2-methyl-N,N-dipentylbutanamide.
| Compound Name | 4-amino-2-methyl-N,N-dipentylbutanamide |
|---|---|
| PubChem CID | 80542996 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 4-amino-2-methyl-N,N-dipentylbutanamide |
| SMILES | CCCCCN(CCCCC)C(=O)C(C)CCN |
| InChI | InChI=1S/C15H32N2O/c1-4-6-8-12-17(13-9-7-5-2)15(18)14(3)10-11-16/h14H,4-13,16H2,1-3H3 |
| InChIKey | MZUOJJIAZIKPOO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|