C12H24ClNO — CID 62728082
N,N-dibutyl-3-chloro-2-methylpropanamide (PubChem CID 62728082) has the molecular formula C12H24ClNO and a molecular weight of 233.78 g/mol. Its IUPAC name is N,N-dibutyl-3-chloro-2-methylpropanamide.
| Compound Name | N,N-dibutyl-3-chloro-2-methylpropanamide |
|---|---|
| PubChem CID | 62728082 |
| Molecular Formula | C12H24ClNO |
| Molecular Weight | 233.78 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N,N-dibutyl-3-chloro-2-methylpropanamide |
| SMILES | CCCCN(CCCC)C(=O)C(C)CCl |
| InChI | InChI=1S/C12H24ClNO/c1-4-6-8-14(9-7-5-2)12(15)11(3)10-13/h11H,4-10H2,1-3H3 |
| InChIKey | YYGGDGSPJADOAY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|