C14H27Cl2NO — CID 533320
2,2-dichloro-N,N-dihexylacetamide (PubChem CID 533320) has the molecular formula C14H27Cl2NO and a molecular weight of 296.28 g/mol. Its IUPAC name is 2,2-dichloro-N,N-dihexylacetamide.
| Compound Name | 2,2-dichloro-N,N-dihexylacetamide |
|---|---|
| PubChem CID | 533320 |
| Molecular Formula | C14H27Cl2NO |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2,2-dichloro-N,N-dihexylacetamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C14H27Cl2NO/c1-3-5-7-9-11-17(14(18)13(15)16)12-10-8-6-4-2/h13H,3-12H2,1-2H3 |
| InChIKey | TXPVLEZUMVIIBX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|