C27H54N2O2 — CID 87219265
N-hexyl-N',2-dimethyl-N,N'-dioctylpropanediamide (PubChem CID 87219265) has the molecular formula C27H54N2O2 and a molecular weight of 438.74 g/mol. Its IUPAC name is N-hexyl-N',2-dimethyl-N,N'-dioctylpropanediamide.
| Compound Name | N-hexyl-N',2-dimethyl-N,N'-dioctylpropanediamide |
|---|---|
| PubChem CID | 87219265 |
| Molecular Formula | C27H54N2O2 |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.42 |
| IUPAC Name | N-hexyl-N',2-dimethyl-N,N'-dioctylpropanediamide |
| SMILES | CCCCCCCCN(C)C(=O)C(C)C(=O)N(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C27H54N2O2/c1-6-9-12-15-17-19-22-28(5)26(30)25(4)27(31)29(23-20-14-11-8-3)24-21-18-16-13-10-7-2/h25H,6-24H2,1-5H3 |
| InChIKey | TXNXQRFAQHCIEF-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|