C20H40N2O3 — CID 614798
N,N'-diheptyl-2-methoxy-N,N'-dimethylpropanediamide (PubChem CID 614798) has the molecular formula C20H40N2O3 and a molecular weight of 356.55 g/mol. Its IUPAC name is N,N'-diheptyl-2-methoxy-N,N'-dimethylpropanediamide.
| Compound Name | N,N'-diheptyl-2-methoxy-N,N'-dimethylpropanediamide |
|---|---|
| PubChem CID | 614798 |
| Molecular Formula | C20H40N2O3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.30 |
| IUPAC Name | N,N'-diheptyl-2-methoxy-N,N'-dimethylpropanediamide |
| SMILES | CCCCCCCN(C)C(=O)C(OC)C(=O)N(C)CCCCCCC |
| InChI | InChI=1S/C20H40N2O3/c1-6-8-10-12-14-16-21(3)19(23)18(25-5)20(24)22(4)17-15-13-11-9-7-2/h18H,6-17H2,1-5H3 |
| InChIKey | LVKMFXSJTHWEEU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|