C30H60N2O4 — CID 11420901
(2R,3R)-N,N,N',N'-tetrahexyl-2,3-dimethoxybutanediamide (PubChem CID 11420901) has the molecular formula C30H60N2O4 and a molecular weight of 512.82 g/mol. Its IUPAC name is (2R,3R)-N,N,N',N'-tetrahexyl-2,3-dimethoxybutanediamide.
| Compound Name | (2R,3R)-N,N,N',N'-tetrahexyl-2,3-dimethoxybutanediamide |
|---|---|
| PubChem CID | 11420901 |
| Molecular Formula | C30H60N2O4 |
| Molecular Weight | 512.82 g/mol |
| Exact Mass | 512.46 |
| IUPAC Name | (2R,3R)-N,N,N',N'-tetrahexyl-2,3-dimethoxybutanediamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)[C@H](OC)[C@@H](OC)C(=O)N(CCCCCC)CCCCCC |
| InChI | InChI=1S/C30H60N2O4/c1-7-11-15-19-23-31(24-20-16-12-8-2)29(33)27(35-5)28(36-6)30(34)32(25-21-17-13-9-3)26-22-18-14-10-4/h27-28H,7-26H2,1-6H3/t27-,28-/m1/s1 |
| InChIKey | LTVBFVIEFRVYBI-VSGBNLITSA-N |
| XLogP | 6.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.82 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|