C20H40N2O4 — CID 54049006
2,3-dihydroxy-N',N'-dioctylbutanediamide (PubChem CID 54049006) has the molecular formula C20H40N2O4 and a molecular weight of 372.55 g/mol. Its IUPAC name is 2,3-dihydroxy-N',N'-dioctylbutanediamide.
| Compound Name | 2,3-dihydroxy-N',N'-dioctylbutanediamide |
|---|---|
| PubChem CID | 54049006 |
| Molecular Formula | C20H40N2O4 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | 2,3-dihydroxy-N',N'-dioctylbutanediamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)C(O)C(O)C(N)=O |
| InChI | InChI=1S/C20H40N2O4/c1-3-5-7-9-11-13-15-22(16-14-12-10-8-6-4-2)20(26)18(24)17(23)19(21)25/h17-18,23-24H,3-16H2,1-2H3,(H2,21,25) |
| InChIKey | LROGLZVEXNZQQH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|