C15H30ClNO — CID 533081
2-chloro-N,N-dihexylpropanamide (PubChem CID 533081) has the molecular formula C15H30ClNO and a molecular weight of 275.86 g/mol. Its IUPAC name is 2-chloro-N,N-dihexylpropanamide.
| Compound Name | 2-chloro-N,N-dihexylpropanamide |
|---|---|
| PubChem CID | 533081 |
| Molecular Formula | C15H30ClNO |
| Molecular Weight | 275.86 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 2-chloro-N,N-dihexylpropanamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)C(C)Cl |
| InChI | InChI=1S/C15H30ClNO/c1-4-6-8-10-12-17(15(18)14(3)16)13-11-9-7-5-2/h14H,4-13H2,1-3H3 |
| InChIKey | CPIHTZXGVWMATK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.86 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|