C17H35NO2 — CID 10039592
N-decyl-N-(2-methoxyethyl)-2-methylpropanamide (PubChem CID 10039592) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is N-decyl-N-(2-methoxyethyl)-2-methylpropanamide.
| Compound Name | N-decyl-N-(2-methoxyethyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 10039592 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | N-decyl-N-(2-methoxyethyl)-2-methylpropanamide |
| SMILES | CCCCCCCCCCN(CCOC)C(=O)C(C)C |
| InChI | InChI=1S/C17H35NO2/c1-5-6-7-8-9-10-11-12-13-18(14-15-20-4)17(19)16(2)3/h16H,5-15H2,1-4H3 |
| InChIKey | AJXQFNPVDLBLNX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|