C12H26N2O2 — CID 81081055
2-amino-N,N-dibutyl-3-methoxypropanamide (PubChem CID 81081055) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-amino-N,N-dibutyl-3-methoxypropanamide.
| Compound Name | 2-amino-N,N-dibutyl-3-methoxypropanamide |
|---|---|
| PubChem CID | 81081055 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-amino-N,N-dibutyl-3-methoxypropanamide |
| SMILES | CCCCN(CCCC)C(=O)C(N)COC |
| InChI | InChI=1S/C12H26N2O2/c1-4-6-8-14(9-7-5-2)12(15)11(13)10-16-3/h11H,4-10,13H2,1-3H3 |
| InChIKey | DLFSVRFQRPVWSD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |