C10H19ClN2O2 — CID 62727427
3-chloro-2-methyl-N-[2-(methylamino)-2-oxoethyl]-N-propylpropanamide (PubChem CID 62727427) has the molecular formula C10H19ClN2O2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[2-(methylamino)-2-oxoethyl]-N-propylpropanamide.
| Compound Name | 3-chloro-2-methyl-N-[2-(methylamino)-2-oxoethyl]-N-propylpropanamide |
|---|---|
| PubChem CID | 62727427 |
| Molecular Formula | C10H19ClN2O2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-chloro-2-methyl-N-[2-(methylamino)-2-oxoethyl]-N-propylpropanamide |
| SMILES | CCCN(CC(=O)NC)C(=O)C(C)CCl |
| InChI | InChI=1S/C10H19ClN2O2/c1-4-5-13(7-9(14)12-3)10(15)8(2)6-11/h8H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | CSFFLOVFIWYOLE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|