C29H62N2O2S — CID 23277407
2-amino-4-methylsulfanylbutanoate;tetrahexylazanium (PubChem CID 23277407) has the molecular formula C29H62N2O2S and a molecular weight of 502.89 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoate;tetrahexylazanium.
| Compound Name | 2-amino-4-methylsulfanylbutanoate;tetrahexylazanium |
|---|---|
| PubChem CID | 23277407 |
| Molecular Formula | C29H62N2O2S |
| Molecular Weight | 502.89 g/mol |
| Exact Mass | 502.45 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoate;tetrahexylazanium |
| SMILES | CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC.CSCCC(N)C(=O)[O-] |
| InChI | InChI=1S/C24H52N.C5H11NO2S/c1-5-9-13-17-21-25(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4;1-9-3-2-4(6)5(7)8/h5-24H2,1-4H3;4H,2-3,6H2,1H3,(H,7,8)/q+1;/p-1 |
| InChIKey | QKBVRXJDXACEBU-UHFFFAOYSA-M |
| XLogP | 6.94 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.89 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|