About lithium 2-aminohexanoate
lithium 2-aminohexanoate (PubChem CID 162134290) has the molecular formula C6H12LiNO2
and a molecular weight of 137.11 g/mol. Its IUPAC name is lithium 2-aminohexanoate.
Molecular Properties
| Compound Name | lithium 2-aminohexanoate |
| PubChem CID | 162134290 |
| Molecular Formula | C6H12LiNO2 |
| Molecular Weight | 137.11 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | lithium 2-aminohexanoate |
| SMILES | CCCCC(N)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C6H13NO2.Li/c1-2-3-4-5(7)6(8)9;/h5H,2-4,7H2,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | ZJBJDLRTFWVXER-UHFFFAOYSA-M |
| XLogP | -3.74 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.11 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium 2-aminohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-aminohexanoate?
The IUPAC name of lithium 2-aminohexanoate (CID 162134290) is lithium 2-aminohexanoate.
What is the SMILES notation for lithium 2-aminohexanoate?
The canonical SMILES for lithium 2-aminohexanoate is CCCCC(N)C(=O)[O-].[Li+].
What is the InChIKey of lithium 2-aminohexanoate?
The InChIKey is ZJBJDLRTFWVXER-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H13NO2.Li/c1-2-3-4-5(7)6(8)9;/h5H,2-4,7H2,1H3,(H,8,9);/q;+1/p-1.
What are the key properties of lithium 2-aminohexanoate?
lithium 2-aminohexanoate has a molecular weight of 137.11 g/mol, XLogP of -3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-aminohexanoate is sourced from PubChem (CID 162134290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).