About calcium (2S)-2-aminohexanedioate
calcium (2S)-2-aminohexanedioate (PubChem CID 141363631) has the molecular formula C6H9CaNO4
and a molecular weight of 199.22 g/mol. Its IUPAC name is calcium (2S)-2-aminohexanedioate.
Molecular Properties
| Compound Name | calcium (2S)-2-aminohexanedioate |
| PubChem CID | 141363631 |
| Molecular Formula | C6H9CaNO4 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | calcium (2S)-2-aminohexanedioate |
| SMILES | N[C@@H](CCCC(=O)[O-])C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C6H11NO4.Ca/c7-4(6(10)11)2-1-3-5(8)9;/h4H,1-3,7H2,(H,8,9)(H,10,11);/q;+2/p-2/t4-;/m0./s1 |
| InChIKey | RZPBYFYRPIQNHU-WCCKRBBISA-L |
| XLogP | -3.40 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze calcium (2S)-2-aminohexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium (2S)-2-aminohexanedioate?
The IUPAC name of calcium (2S)-2-aminohexanedioate (CID 141363631) is calcium (2S)-2-aminohexanedioate.
What is the SMILES notation for calcium (2S)-2-aminohexanedioate?
The canonical SMILES for calcium (2S)-2-aminohexanedioate is N[C@@H](CCCC(=O)[O-])C(=O)[O-].[Ca+2].
What is the InChIKey of calcium (2S)-2-aminohexanedioate?
The InChIKey is RZPBYFYRPIQNHU-WCCKRBBISA-L. The full InChI is InChI=1S/C6H11NO4.Ca/c7-4(6(10)11)2-1-3-5(8)9;/h4H,1-3,7H2,(H,8,9)(H,10,11);/q;+2/p-2/t4-;/m0./s1.
What are the key properties of calcium (2S)-2-aminohexanedioate?
calcium (2S)-2-aminohexanedioate has a molecular weight of 199.22 g/mol, XLogP of -3.40, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium (2S)-2-aminohexanedioate is sourced from PubChem (CID 141363631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).