About diazanium;2-aminopentanedioate
diazanium;2-aminopentanedioate (PubChem CID 22497325) has the molecular formula C5H15N3O4
and a molecular weight of 181.19 g/mol. Its IUPAC name is diazanium;2-aminopentanedioate.
Molecular Properties
| Compound Name | diazanium;2-aminopentanedioate |
| PubChem CID | 22497325 |
| Molecular Formula | C5H15N3O4 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | diazanium;2-aminopentanedioate |
| SMILES | NC(CCC(=O)[O-])C(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C5H9NO4.2H3N/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);2*1H3 |
| InChIKey | HCGIOFQTKHOCPM-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 179.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diazanium;2-aminopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;2-aminopentanedioate?
The IUPAC name of diazanium;2-aminopentanedioate (CID 22497325) is diazanium;2-aminopentanedioate.
What is the SMILES notation for diazanium;2-aminopentanedioate?
The canonical SMILES for diazanium;2-aminopentanedioate is NC(CCC(=O)[O-])C(=O)[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;2-aminopentanedioate?
The InChIKey is HCGIOFQTKHOCPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4.2H3N/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);2*1H3.
What are the key properties of diazanium;2-aminopentanedioate?
diazanium;2-aminopentanedioate has a molecular weight of 181.19 g/mol, XLogP of -2.65, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;2-aminopentanedioate is sourced from PubChem (CID 22497325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).