C7H13NNa2O6 — CID 174730127
disodium;2-aminopentanedioate;ethane-1,2-diol (PubChem CID 174730127) has the molecular formula C7H13NNa2O6 and a molecular weight of 253.16 g/mol. Its IUPAC name is disodium;2-aminopentanedioate;ethane-1,2-diol.
| Compound Name | disodium;2-aminopentanedioate;ethane-1,2-diol |
|---|---|
| PubChem CID | 174730127 |
| Molecular Formula | C7H13NNa2O6 |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | disodium;2-aminopentanedioate;ethane-1,2-diol |
| SMILES | NC(CCC(=O)[O-])C(=O)[O-].OCCO.[Na+].[Na+] |
| InChI | InChI=1S/C5H9NO4.C2H6O2.2Na/c6-3(5(9)10)1-2-4(7)8;3-1-2-4;;/h3H,1-2,6H2,(H,7,8)(H,9,10);3-4H,1-2H2;;/q;;2*+1/p-2 |
| InChIKey | LRIKLEMZFWSYKT-UHFFFAOYSA-L |
| XLogP | -10.43 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | -10.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |