About strontium;(2R)-2-aminopentanedioate;hydrate
strontium;(2R)-2-aminopentanedioate;hydrate (PubChem CID 141288425) has the molecular formula C5H9NO5Sr
and a molecular weight of 250.75 g/mol. Its IUPAC name is strontium;(2R)-2-aminopentanedioate;hydrate.
Molecular Properties
| Compound Name | strontium;(2R)-2-aminopentanedioate;hydrate |
| PubChem CID | 141288425 |
| Molecular Formula | C5H9NO5Sr |
| Molecular Weight | 250.75 g/mol |
| Exact Mass | 250.95 |
| IUPAC Name | strontium;(2R)-2-aminopentanedioate;hydrate |
| SMILES | N[C@H](CCC(=O)[O-])C(=O)[O-].O.[Sr+2] |
| InChI | InChI=1S/C5H9NO4.H2O.Sr/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H2;/q;;+2/p-2/t3-;;/m1../s1 |
| InChIKey | FNGRACUKFZAZSI-HWYNEVGZSA-L |
| XLogP | -4.61 |
| TPSA | 137.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.75 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze strontium;(2R)-2-aminopentanedioate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium;(2R)-2-aminopentanedioate;hydrate?
The IUPAC name of strontium;(2R)-2-aminopentanedioate;hydrate (CID 141288425) is strontium;(2R)-2-aminopentanedioate;hydrate.
What is the SMILES notation for strontium;(2R)-2-aminopentanedioate;hydrate?
The canonical SMILES for strontium;(2R)-2-aminopentanedioate;hydrate is N[C@H](CCC(=O)[O-])C(=O)[O-].O.[Sr+2].
What is the InChIKey of strontium;(2R)-2-aminopentanedioate;hydrate?
The InChIKey is FNGRACUKFZAZSI-HWYNEVGZSA-L. The full InChI is InChI=1S/C5H9NO4.H2O.Sr/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H2;/q;;+2/p-2/t3-;;/m1../s1.
What are the key properties of strontium;(2R)-2-aminopentanedioate;hydrate?
strontium;(2R)-2-aminopentanedioate;hydrate has a molecular weight of 250.75 g/mol, XLogP of -4.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for strontium;(2R)-2-aminopentanedioate;hydrate is sourced from PubChem (CID 141288425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).