About strontium;(2S)-2-aminopentanedioate;pentahydrate
strontium;(2S)-2-aminopentanedioate;pentahydrate (PubChem CID 172813696) has the molecular formula C5H17NO9Sr
and a molecular weight of 322.81 g/mol. Its IUPAC name is strontium;(2S)-2-aminopentanedioate;pentahydrate.
Molecular Properties
| Compound Name | strontium;(2S)-2-aminopentanedioate;pentahydrate |
| PubChem CID | 172813696 |
| Molecular Formula | C5H17NO9Sr |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | strontium;(2S)-2-aminopentanedioate;pentahydrate |
| SMILES | N[C@@H](CCC(=O)[O-])C(=O)[O-].O.O.O.O.O.[Sr+2] |
| InChI | InChI=1S/C5H9NO4.5H2O.Sr/c6-3(5(9)10)1-2-4(7)8;;;;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);5*1H2;/q;;;;;;+2/p-2/t3-;;;;;;/m0....../s1 |
| InChIKey | SNKCISREKSEASG-YTJAIRILSA-L |
| XLogP | -7.91 |
| TPSA | 263.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | -7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze strontium;(2S)-2-aminopentanedioate;pentahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium;(2S)-2-aminopentanedioate;pentahydrate?
The IUPAC name of strontium;(2S)-2-aminopentanedioate;pentahydrate (CID 172813696) is strontium;(2S)-2-aminopentanedioate;pentahydrate.
What is the SMILES notation for strontium;(2S)-2-aminopentanedioate;pentahydrate?
The canonical SMILES for strontium;(2S)-2-aminopentanedioate;pentahydrate is N[C@@H](CCC(=O)[O-])C(=O)[O-].O.O.O.O.O.[Sr+2].
What is the InChIKey of strontium;(2S)-2-aminopentanedioate;pentahydrate?
The InChIKey is SNKCISREKSEASG-YTJAIRILSA-L. The full InChI is InChI=1S/C5H9NO4.5H2O.Sr/c6-3(5(9)10)1-2-4(7)8;;;;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);5*1H2;/q;;;;;;+2/p-2/t3-;;;;;;/m0....../s1.
What are the key properties of strontium;(2S)-2-aminopentanedioate;pentahydrate?
strontium;(2S)-2-aminopentanedioate;pentahydrate has a molecular weight of 322.81 g/mol, XLogP of -7.91, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for strontium;(2S)-2-aminopentanedioate;pentahydrate is sourced from PubChem (CID 172813696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).