C9H13NNa4O8 — CID 18668480
tetrasodium;2-aminopentanedioate;diacetate (PubChem CID 18668480) has the molecular formula C9H13NNa4O8 and a molecular weight of 355.16 g/mol. Its IUPAC name is tetrasodium;2-aminopentanedioate;diacetate.
| Compound Name | tetrasodium;2-aminopentanedioate;diacetate |
|---|---|
| PubChem CID | 18668480 |
| Molecular Formula | C9H13NNa4O8 |
| Molecular Weight | 355.16 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | tetrasodium;2-aminopentanedioate;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].NC(CCC(=O)[O-])C(=O)[O-].[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C5H9NO4.2C2H4O2.4Na/c6-3(5(9)10)1-2-4(7)8;2*1-2(3)4;;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);2*1H3,(H,3,4);;;;/q;;;4*+1/p-4 |
| InChIKey | OAQLGYBPVLTRSP-UHFFFAOYSA-J |
| XLogP | -17.88 |
| TPSA | 186.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.16 |
| LogP ≤ 5 | -17.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |