C7H7NNa4O8 — CID 175012253
tetrasodium;2-aminopentanedioate;oxalate (PubChem CID 175012253) has the molecular formula C7H7NNa4O8 and a molecular weight of 325.09 g/mol. Its IUPAC name is tetrasodium;2-aminopentanedioate;oxalate.
| Compound Name | tetrasodium;2-aminopentanedioate;oxalate |
|---|---|
| PubChem CID | 175012253 |
| Molecular Formula | C7H7NNa4O8 |
| Molecular Weight | 325.09 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | tetrasodium;2-aminopentanedioate;oxalate |
| SMILES | NC(CCC(=O)[O-])C(=O)[O-].O=C([O-])C(=O)[O-].[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C5H9NO4.C2H2O4.4Na/c6-3(5(9)10)1-2-4(7)8;3-1(4)2(5)6;;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);(H,3,4)(H,5,6);;;;/q;;4*+1/p-4 |
| InChIKey | MQJSAMHWABUSNQ-UHFFFAOYSA-J |
| XLogP | -18.90 |
| TPSA | 186.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.09 |
| LogP ≤ 5 | -18.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|