About (2S)-2-aminopentanedioate;manganese(2+)
(2S)-2-aminopentanedioate;manganese(2+) (PubChem CID 10442757) has the molecular formula C5H7MnNO4
and a molecular weight of 200.05 g/mol. Its IUPAC name is (2S)-2-aminopentanedioate;manganese(2+).
Molecular Properties
| Compound Name | (2S)-2-aminopentanedioate;manganese(2+) |
| PubChem CID | 10442757 |
| Molecular Formula | C5H7MnNO4 |
| Molecular Weight | 200.05 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | (2S)-2-aminopentanedioate;manganese(2+) |
| SMILES | N[C@@H](CCC(=O)[O-])C(=O)[O-].[Mn+2] |
| InChI | InChI=1S/C5H9NO4.Mn/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+2/p-2/t3-;/m0./s1 |
| InChIKey | CFSIMSPVBRMSRX-DFWYDOINSA-L |
| XLogP | -3.41 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.05 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-aminopentanedioate;manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopentanedioate;manganese(2+)?
The IUPAC name of (2S)-2-aminopentanedioate;manganese(2+) (CID 10442757) is (2S)-2-aminopentanedioate;manganese(2+).
What is the SMILES notation for (2S)-2-aminopentanedioate;manganese(2+)?
The canonical SMILES for (2S)-2-aminopentanedioate;manganese(2+) is N[C@@H](CCC(=O)[O-])C(=O)[O-].[Mn+2].
What is the InChIKey of (2S)-2-aminopentanedioate;manganese(2+)?
The InChIKey is CFSIMSPVBRMSRX-DFWYDOINSA-L. The full InChI is InChI=1S/C5H9NO4.Mn/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+2/p-2/t3-;/m0./s1.
What are the key properties of (2S)-2-aminopentanedioate;manganese(2+)?
(2S)-2-aminopentanedioate;manganese(2+) has a molecular weight of 200.05 g/mol, XLogP of -3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopentanedioate;manganese(2+) is sourced from PubChem (CID 10442757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).