C20H43N3O3 — CID 155818037
(2S)-2,4-diamino-4-oxobutanoate;tetrabutylazanium (PubChem CID 155818037) has the molecular formula C20H43N3O3 and a molecular weight of 373.58 g/mol. Its IUPAC name is (2S)-2,4-diamino-4-oxobutanoate;tetrabutylazanium.
| Compound Name | (2S)-2,4-diamino-4-oxobutanoate;tetrabutylazanium |
|---|---|
| PubChem CID | 155818037 |
| Molecular Formula | C20H43N3O3 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | (2S)-2,4-diamino-4-oxobutanoate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.NC(=O)C[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C16H36N.C4H8N2O3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;5-2(4(8)9)1-3(6)7/h5-16H2,1-4H3;2H,1,5H2,(H2,6,7)(H,8,9)/q+1;/p-1/t;2-/m.0/s1 |
| InChIKey | BDKNYFODTAXZLH-WNQIDUERSA-M |
| XLogP | 1.94 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|