C24H44N2O3 — CID 172680279
2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium (PubChem CID 172680279) has the molecular formula C24H44N2O3 and a molecular weight of 408.63 g/mol. Its IUPAC name is 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium.
| Compound Name | 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium |
|---|---|
| PubChem CID | 172680279 |
| Molecular Formula | C24H44N2O3 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.NC(C(=O)[O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C16H36N.C8H9NO3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;9-7(8(11)12)5-1-3-6(10)4-2-5/h5-16H2,1-4H3;1-4,7,10H,9H2,(H,11,12)/q+1;/p-1 |
| InChIKey | AHKIXVDPDJRSGY-UHFFFAOYSA-M |
| XLogP | 4.15 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|