About 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium
2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium (PubChem CID 172680279) has the molecular formula C24H44N2O3
and a molecular weight of 408.63 g/mol. Its IUPAC name is 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium.
Molecular Properties
| Compound Name | 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium |
| PubChem CID | 172680279 |
| Molecular Formula | C24H44N2O3 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.NC(C(=O)[O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C16H36N.C8H9NO3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;9-7(8(11)12)5-1-3-6(10)4-2-5/h5-16H2,1-4H3;1-4,7,10H,9H2,(H,11,12)/q+1;/p-1 |
| InChIKey | AHKIXVDPDJRSGY-UHFFFAOYSA-M |
| XLogP | 4.15 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium?
The IUPAC name of 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium (CID 172680279) is 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium.
What is the SMILES notation for 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium?
The canonical SMILES for 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.NC(C(=O)[O-])c1ccc(O)cc1.
What is the InChIKey of 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium?
The InChIKey is AHKIXVDPDJRSGY-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C8H9NO3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;9-7(8(11)12)5-1-3-6(10)4-2-5/h5-16H2,1-4H3;1-4,7,10H,9H2,(H,11,12)/q+1;/p-1.
What are the key properties of 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium?
2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium has a molecular weight of 408.63 g/mol, XLogP of 4.15, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(4-hydroxyphenyl)acetate;tetrabutylazanium is sourced from PubChem (CID 172680279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).