C15H31F2NO2 — CID 127262882
2,2-difluoroacetate;tributyl(methyl)azanium (PubChem CID 127262882) has the molecular formula C15H31F2NO2 and a molecular weight of 295.41 g/mol. Its IUPAC name is 2,2-difluoroacetate;tributyl(methyl)azanium.
| Compound Name | 2,2-difluoroacetate;tributyl(methyl)azanium |
|---|---|
| PubChem CID | 127262882 |
| Molecular Formula | C15H31F2NO2 |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2,2-difluoroacetate;tributyl(methyl)azanium |
| SMILES | CCCC[N+](C)(CCCC)CCCC.O=C([O-])C(F)F |
| InChI | InChI=1S/C13H30N.C2H2F2O2/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;3-1(4)2(5)6/h5-13H2,1-4H3;1H,(H,5,6)/q+1;/p-1 |
| InChIKey | VAOJZXCSHCBYFL-UHFFFAOYSA-M |
| XLogP | 2.83 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|